CAS 36651-81-7

8-hydroxy-5-methyl-2H-chromen-2-one

Description:

8-Hydroxy-5-methyl-2H-chromen-2-one, commonly known as "flavonol," is a chemical compound belonging to the flavonoid class, characterized by its chromenone structure. This compound features a hydroxyl group at the 8-position and a methyl group at the 5-position of the chromenone ring, contributing to its unique properties. It typically exhibits a yellow to orange color in solid form and is soluble in organic solvents such as ethanol and methanol, but less soluble in water. The presence of the hydroxyl group enhances its antioxidant activity, making it of interest in various biological and pharmaceutical applications. Additionally, it may exhibit anti-inflammatory and antimicrobial properties, which are common among flavonoids. The compound's structure allows for potential interactions with biological systems, influencing enzyme activity and cellular signaling pathways. Its CAS number, 36651-81-7, is used for identification in chemical databases and regulatory contexts. Overall, 8-hydroxy-5-methyl-2H-chromen-2-one is a significant compound in the study of natural products and their potential health benefits.

Formula: C₁₀H₈O₃

InChI: InChI=1/C10H8O3/c1-6-2-4-8(11)10-7(6)3-5-9(12)13-10/h2-5,11H,1H3

SMILES: Cc1ccc(c2c1ccc(=O)o2)O

Synonyms:

• 2H-1-benzopyran-2-one, 8-hydroxy-5-methyl-

5-methyl-8-hydroxycoumarin

CAS: 36651-81-7

Formula: C₁₀H₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 176.1687

Ref: IN-DA00D2SD

5-Methyl-8-hydroxycoumarin

CAS: 36651-81-7

5-Methyl-8-hydroxycoumarin

Purity: >98%

Molecular weight: 176.17g/mol

Ref: 54-OR370038

5-Methyl-8-hydroxycoumarin

CAS: 36651-81-7

Purity: 98%

Molecular weight: 176.1710052

Ref: 10-F788085

5-Methyl-8-hydroxycoumarin

Controlled Product

CAS: 36651-81-7

Formula: C₁₀H₈O₃

Color and Shape: Neat

Molecular weight: 176.17

Ref: TR-M299260