CymitQuimica logo

CAS 366793-17-1

:

N-hexylhexan-1-amine acetate

Description:
N-hexylhexan-1-amine acetate is an organic compound characterized by its amine and acetate functional groups. It features a hexyl chain, which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The presence of the acetate group indicates that it can participate in various chemical reactions, including esterification and hydrolysis. This compound is likely to exhibit moderate volatility and may have a distinct odor, typical of amines. Its molecular structure suggests potential applications in fields such as pharmaceuticals, agrochemicals, or as a surfactant due to its amphiphilic nature. Additionally, the compound's properties, such as boiling point, melting point, and reactivity, would be influenced by the length of the alkyl chains and the overall molecular weight. Safety data should be consulted for handling and storage, as amines can be irritants and may pose health risks. Overall, N-hexylhexan-1-amine acetate represents a versatile chemical with potential utility in various industrial applications.
Formula:C14H31NO2
InChI:InChI=1/C12H27N.C2H4O2/c1-3-5-7-9-11-13-12-10-8-6-4-2;1-2(3)4/h13H,3-12H2,1-2H3;1H3,(H,3,4)
SMILES:CCCCCCNCCCCCC.CC(=O)O
Synonyms:
  • 1-hexanamine, N-hexyl-, acetate (1:1)
  • N-Hexylhexan-1-aminium acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.