CAS 366814-43-9: Pulsatilloside E
Description:Pulsatilloside E is a chemical compound classified as a saponin, which is a type of glycoside known for its surface-active properties. It is derived from various plant sources, particularly those belonging to the Ranunculaceae family. This compound is characterized by its complex structure, which typically includes a steroid or triterpenoid aglycone linked to one or more sugar moieties. Pulsatilloside E exhibits various biological activities, including potential anti-inflammatory and immunomodulatory effects, making it of interest in pharmacological research. Its solubility in water and ability to form micelles contribute to its surfactant properties, which can influence its bioavailability and interaction with biological membranes. Additionally, saponins like Pulsatilloside E are known for their ability to create foams and emulsions, which can be utilized in various applications, including cosmetics and food products. However, the specific pharmacokinetics, toxicity, and therapeutic potential of Pulsatilloside E require further investigation to fully understand its implications in medicinal chemistry and natural product research.
Formula:C65H106O31
InChI:InChI=1S/C65H106O31/c1-24(2)27-11-16-65(60(84)96-58-50(82)45(77)40(72)31(91-58)21-85-54-51(83)46(78)52(30(20-67)90-54)94-55-47(79)42(74)37(69)25(3)87-55)18-17-63(7)28(36(27)65)9-10-34-61(5)14-13-35(62(6,23-68)33(61)12-15-64(34,63)8)93-59-53(95-56-48(80)43(75)38(70)26(4)88-56)41(73)32(22-86-59)92-57-49(81)44(76)39(71)29(19-66)89-57/h25-59,66-83H,1,9-23H2,2-8H3/t25-,26-,27-,28+,29+,30+,31+,32-,33+,34+,35-,36+,37-,38-,39+,40+,41-,42+,43+,44-,45-,46+,47+,48+,49+,50+,51+,52+,53+,54+,55-,56-,57-,58-,59-,61-,62-,63+,64+,65-/m0/s1
InChI key:InChIKey=WKNXZHOQPHRDKT-RUGHYGOFSA-N
SMILES:O=C(OC1OC(COC2OC(CO)C(OC3OC(C)C(O)C(O)C3O)C(O)C2O)C(O)C(O)C1O)C45CCC(C(=C)C)C5C6CCC7C8(C)CCC(OC9OCC(OC%10OC(CO)C(O)C(O)C%10O)C(O)C9OC%11OC(C)C(O)C(O)C%11O)C(C)(CO)C8CCC7(C)C6(C)CC4
- Synonyms:
- 3-O-[β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl(1→4)][α-<smallcap>L</smallcap>-rhamnopyranosyl(1→2)]-α-<smallcap>L</smallcap>-arabinopyranosyl-23-hydroxybetulinic acid 28-O-α-<smallcap>L</smallcap>-rhamnopyranosyl(1→4)-β-<smallcap>D</smallcap>-glucopyranosyl(1→6)-β-<smallcap>D</span>-glucopyranosyl ester
- Lup-20(29)-en-28-oic acid, 3-[(O-6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl-(1→2)-O-[β-<smallcap>D</smallcap>-glucopyranosyl-(1→4)]-α-<smallcap>L</smallcap>-arabinopyranosyl)oxy]-23-hydroxy-, O-6-deoxy-α-<smallcap>L</smallcap>-mannopyranosyl-(1→4)-O-β-<smallcap>D</smallcap>-glucopyranosyl-(1→6)-β-<smallcap>D</span>-glucopyranosyl ester, (3β,4α)-
- Pulsatilloside E
- 3-O-[β-D-glucopyranosyl(1→4)][α-L-rhamnopyranosyl(1→2)]-α-L-arabinopyranosyl-23-hydroxybetulinic acid 28-O-α-L-rhamnopyranosyl(1→4)-β-D-glucopyranosyl(1→6)-β-D-glucopyranosyl ester
- Chinensioside B
- Lup-20(29)-en-28-oic acid, 3-[(O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→4)]-α-L-arabinopyranosyl)oxy]-23-hydroxy-, O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl ester, (3β,4α)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Pulsatilloside E REF: 7W-GY2621CAS: 366814-43-9 | - - - | To inquire | Mon 05 May 25 |
![]() | Pulsatilloside E REF: BP-BP0344CAS: 366814-43-9 | 95%~99% | 256.00 €~643.00 € | Wed 07 May 25 |
![]() | Pulsatilloside E REF: TM-TN2117CAS: 366814-43-9 | 99.95% | 113.00 € | Tue 13 May 25 |
![]() | Pulsatilloside E REF: 3D-RPA81443CAS: 366814-43-9 | Min. 95% | - - - | Discontinued product |

Ref: 7W-GY2621
Undefined size | To inquire |

Ref: BP-BP0344
5mg | 256.00 € | ||
10mg | 453.00 € | ||
20mg | 643.00 € |

Pulsatilloside E
Ref: TM-TN2117
1mg | 113.00 € |

Pulsatilloside E
Ref: 3D-RPA81443
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information |