
CAS 36695-19-9
:6-Acetyl-5-hydroxy-4-methyl-2H-1-benzopyran-2-one
Description:
6-Acetyl-5-hydroxy-4-methyl-2H-1-benzopyran-2-one, also known as a flavonoid compound, is characterized by its unique chemical structure that includes a benzopyran ring system. This compound typically exhibits a yellow to orange color, which is common among flavonoids due to their conjugated double bond systems. It is soluble in organic solvents and may have limited solubility in water, reflecting its hydrophobic characteristics. The presence of the acetyl and hydroxy groups contributes to its reactivity and potential biological activity, including antioxidant properties. This compound may be of interest in various fields, including pharmaceuticals and food chemistry, due to its potential health benefits. Additionally, it may exhibit UV-absorbing properties, making it useful in cosmetic formulations. Its molecular structure allows for various interactions with biological systems, which could lead to further exploration in medicinal chemistry and natural product research. Overall, 6-Acetyl-5-hydroxy-4-methyl-2H-1-benzopyran-2-one represents a significant compound within the flavonoid class, with diverse applications and implications in health and industry.
Formula:C12H10O4
InChI:InChI=1S/C12H10O4/c1-6-5-10(14)16-9-4-3-8(7(2)13)12(15)11(6)9/h3-5,15H,1-2H3
InChI key:InChIKey=UMNMVZFOKSPTJN-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC=C1C(C)=O)OC(=O)C=C2C
Synonyms:- 6-Acetyl-5-hydroxy-4-methylcoumarin
- Liqcoumarin
- Coumarin, 6-acetyl-5-hydroxy-4-methyl-
- 2H-1-Benzopyran-2-one, 6-acetyl-5-hydroxy-4-methyl-
- 6-Acetyl-5-hydroxy-4-methyl-2H-1-benzopyran-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Liqcoumarin
CAS:Liqcoumarin, a hydroxycoumarin found in cytoplasm, herbs, spices, and tea, may indicate their consumption.Formula:C12H10O4Color and Shape:SolidMolecular weight:218.21
