CAS 367-83-9: 2-fluoro-5-methoxybenzoic acid

Description:2-Fluoro-5-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a methoxy group on a benzoic acid framework. The molecular structure features a benzene ring with a carboxylic acid (-COOH) group, a methoxy group (-OCH3) at the 5-position, and a fluorine atom at the 2-position. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic methoxy group. It exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and nucleophilic substitution. The presence of the fluorine atom can influence the compound's reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, its unique substituents can affect its physical properties, such as melting point and boiling point, as well as its interaction with biological systems. Overall, 2-fluoro-5-methoxybenzoic acid is a versatile compound with potential applications in various fields of chemistry.

Formula:C₈H₇FO₃

InChI:InChI=1/C8H7FO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)

Synonyms:
Benzoic acid, 2-fluoro-5-methoxy-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2-Fluoro-5-methoxybenzoic acid, 97+% REF: 02-H52365CAS: 367-83-9	97+%	To inquire	Tue 08 Apr 25
2-Fluoro-5-methoxybenzoic acid REF: IN-DA00789WCAS: 367-83-9	98%	26.00 €~222.00 €	Mon 14 Apr 25
2-Fluoro-5-methoxybenzoic acid REF: 54-PC8208CAS: 367-83-9	- - -	32.00 €~54.00 €	Tue 15 Apr 25
2-Fluoro-5-methoxybenzoic acid REF: 10-F013327CAS: 367-83-9	97.0%	To inquire	Tue 22 Apr 25
2-Fluoro-5-(methyloxy)benzoic acid REF: 3D-FF102220CAS: 367-83-9	Min. 95%	- - -	Discontinued product