CAS 36700-45-5
:[8]-Shogaol
Description:
[8]-Shogaol is a bioactive compound primarily found in ginger (Zingiber officinale), known for its potential health benefits. It is a phenolic compound and a derivative of gingerol, formed through the dehydration of gingerol during the drying process of ginger. Characteristically, [8]-Shogaol exhibits a pungent flavor and aroma, contributing to the distinctive taste of ginger. It is recognized for its anti-inflammatory, antioxidant, and anticancer properties, making it a subject of interest in nutritional and medicinal research. The compound has been studied for its ability to modulate various biological pathways, including those involved in pain relief and metabolic regulation. In terms of physical properties, [8]-Shogaol is typically a yellowish oil or solid at room temperature, with moderate solubility in organic solvents. Its stability can be influenced by factors such as temperature and pH, which are important considerations in both food science and pharmacology. Overall, [8]-Shogaol represents a significant component of ginger's therapeutic potential, highlighting the importance of natural products in health and wellness.
Formula:C19H28O3
InChI:InChI=1S/C19H28O3/c1-3-4-5-6-7-8-9-10-17(20)13-11-16-12-14-18(21)19(15-16)22-2/h9-10,12,14-15,21H,3-8,11,13H2,1-2H3
InChI key:InChIKey=LGZSMXJRMTYABD-UHFFFAOYSA-N
SMILES:C(CC(C=CCCCCCCC)=O)C1=CC(OC)=C(O)C=C1
Synonyms:- 1-(4-Hydroxy-3-methoxyphenyl)-4-dodecen-3-one
- 4-Dodecen-3-one, 1-(4-hydroxy-3-methoxyphenyl)-
- 4-dodecen-3-one, 1-(4-hydroxy-3-methoxyphenyl)-, (4E)-
- [8]-Shogaol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
8-Shogaol
CAS:Formula:C19H28O3Purity:(HPLC) ≥ 95.0%Color and Shape:Colourless to light yellow viscous liquid or solidMolecular weight:304.42[8]-Shogaol
CAS:[8]-Shogaol is a component of ginger and maintains anti-inflammatory activity as a cyclooxygenase-2 inhibitor.Formula:C19H28O3Purity:97.01%Color and Shape:SolidMolecular weight:304.428-shogaol
CAS:Ketone with other oxygen functionsFormula:C19H28O3Purity:≥ 90.0 % (HPLC)Color and Shape:Viscous liquidMolecular weight:304.428-Shogaol
CAS:<p>8-Shogaol is a bioactive compound, which is a potent constituent found in ginger (Zingiber officinale). It is primarily obtained from the dehydration of gingerol during the drying or cooking process of ginger. With its distinctive structure, 8-Shogaol exhibits a pronounced mode of action encompassing anti-inflammatory, anti-cancer, and antioxidant activities. The compound operates by modulating signaling pathways such as NF-κB and by inducing apoptosis in cancer cells. Additionally, 8-Shogaol inhibits the proliferation and migration of tumor cells, making it a compound of significant interest in cancer research.</p>Formula:C19H28O3Purity:Min. 95%Molecular weight:304.42 g/mol







