CAS 36701-90-3

Methyl 2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxylate

Description:

Methyl 2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxylate, identified by its CAS number 36701-90-3, is an organic compound characterized by its complex structure, which includes a pyridine ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate to high stability under standard conditions and potential reactivity due to the presence of functional groups. The trifluoromethyl group contributes to its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical applications. Additionally, the methyl ester functional group can participate in various chemical reactions, including hydrolysis and transesterification. Methyl 2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxylate may also exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its unique structure and properties make it a valuable compound for research in medicinal chemistry and material science.

Formula: C₁₄H₁₀F₃NO₃

InChI: InChI=1S/C14H10F3NO3/c1-20-13(19)11-6-3-7-18-12(11)21-10-5-2-4-9(8-10)14(15,16)17/h2-8H,1H3

InChI key: InChIKey=ZZLJRYFTUVISBQ-UHFFFAOYSA-N

SMILES: O(C1=C(C(OC)=O)C=CC=N1)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• Methyl 2-(3-trifluoromethyl)phenoxynicotinate
• Methyl 2-[3-(trifluoromethyl)phenoxy]-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 2-[3-(trifluoromethyl)phenoxy]-, methyl ester