CAS 36716-71-9

4-(4-chlorophenyl)-4-hydroxycyclohexanone

Description:

4-(4-Chlorophenyl)-4-hydroxycyclohexanone, with the CAS number 36716-71-9, is an organic compound characterized by its cyclohexanone structure substituted with a hydroxyl group and a para-chlorophenyl group. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and organic synthesis. The presence of the hydroxyl group contributes to its polarity, influencing its solubility in various solvents, while the chlorophenyl moiety can affect its reactivity and biological activity. The compound may exhibit various functional properties, including potential antioxidant or anti-inflammatory activities, depending on its specific interactions within biological systems. Its synthesis often involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. As with many organic compounds, safety precautions should be observed when handling it, given the potential hazards associated with chlorinated compounds.

Formula: C₁₂H₁₃ClO₂

InChI: InChI=1/C12H13ClO2/c13-10-3-1-9(2-4-10)12(15)7-5-11(14)6-8-12/h1-4,15H,5-8H2

SMILES: c1cc(ccc1C1(CCC(=O)CC1)O)Cl

4-(4-Chlorophenyl)-4-hydroxycyclohexanone

CAS: 36716-71-9

Formula: C₁₂H₁₃ClO₂

Color and Shape: Solid

Molecular weight: 224.6834

Ref: IN-DA00C9C6

4-(4-Chlorophenyl)-4-hydroxycyclohexanone

Controlled Product

CAS: 36716-71-9

Applications 4-(4-Chlorophenyl)-4-hydroxycyclohexanone (cas# 36716-71-9) is a compound useful in organic synthesis.

Formula: C₁₂H₁₃ClO₂

Color and Shape: Neat

Molecular weight: 224.68

Ref: TR-C379535