CAS 36721-12-7

4-Chloro-3-cinnolinecarbonitrile

Description:

4-Chloro-3-cinnolinecarbonitrile is an organic compound characterized by its unique structure, which includes a chloro substituent and a cyano group attached to a cinnoline ring system. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the chloro group can influence its reactivity and solubility, while the cyano group may contribute to its electronic properties. 4-Chloro-3-cinnolinecarbonitrile is often synthesized through specific chemical reactions involving precursors that contain the necessary functional groups. Its properties, such as melting point, boiling point, and solubility, can vary based on the conditions under which it is synthesized and purified. Additionally, like many nitriles, it may exhibit toxicity and should be handled with care in laboratory settings. Overall, this compound represents a class of heterocyclic compounds that are of interest in various fields of chemical research.

Formula: C₉H₄ClN₃

InChI: InChI=1S/C9H4ClN3/c10-9-6-3-1-2-4-7(6)12-13-8(9)5-11/h1-4H

InChI key: InChIKey=QGKKAKSMBUIJMS-UHFFFAOYSA-N

SMILES: ClC=1C2=C(N=NC1C#N)C=CC=C2

Synonyms:

• 4-Chloro-3-cinnolinecarbonitrile
• 4-Chlorocinnoline-3-carbonitrile
• 3-Cinnolinecarbonitrile, 4-chloro-

4-Chlorocinnoline-3-carbonitrile

CAS: 36721-12-7

4-Chlorocinnoline-3-carbonitrile is a heterocyclic compound with the molecular formula C6H5ClN. It is a pyridine derivative that has been used in the synthesis of other heterocycles, such as cinnolines and thioglycolates. The compound can be prepared by condensation reactions between hydrazine and thiourea or by catalytic hydrogenation of 4-chlorothiophene. 4-Chlorocinnoline-3-carbonitrile has been shown to have antiplatelet aggregation activity and inhibitory effects on the growth of certain bacteria.

Formula: C₉H₄ClN₃

Purity: Min. 95%

Molecular weight: 189.6 g/mol

Ref: 3D-LBA72112