CAS 367272-52-4

D-Lysine, N6-[(9H-fluoren-9-ylmethoxy)carbonyl]-, monohydrochloride

Description:

D-Lysine, N6-[(9H-fluoren-9-ylmethoxy)carbonyl]-, monohydrochloride is a derivative of the amino acid lysine, modified to include a fluorenylmethoxycarbonyl (Fmoc) protecting group at the N6 position. This compound is typically utilized in peptide synthesis as a protective group that can be removed under specific conditions, allowing for selective reactions at other functional groups. The presence of the hydrochloride indicates that the compound is in its salt form, which can enhance its solubility in aqueous solutions. D-Lysine itself is a basic amino acid, characterized by its positively charged side chain at physiological pH, which contributes to its role in protein synthesis and various metabolic processes. The Fmoc group is particularly valued in solid-phase peptide synthesis due to its stability under basic conditions and ease of removal with mild acid. Overall, this compound is significant in biochemical research and pharmaceutical applications, especially in the development of peptide-based drugs.

Formula: C₂₁H₂₄N₂O₄·ClH

InChI: InChI=1S/C21H24N2O4.ClH/c22-19(20(24)25)11-5-6-12-23-21(26)27-13-18-16-9-3-1-7-14(16)15-8-2-4-10-17(15)18;/h1-4,7-10,18-19H,5-6,11-13,22H2,(H,23,26)(H,24,25);1H/t19-;/m1./s1

InChI key: InChIKey=BSLVUEJQCVSAGF-FSRHSHDFSA-N

SMILES: C(OC(NCCCC[C@H](C(O)=O)N)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2.Cl

Synonyms:

• D-Lysine, N6-[(9H-fluoren-9-ylmethoxy)carbonyl]-, monohydrochloride

N6-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-lysine monohydrochloride

CAS: 367272-52-4

Versatile small molecule scaffold

Formula: C₂₁H₂₅ClN₂O₄

Purity: Min. 95%

Molecular weight: 404.89 g/mol

Ref: 3D-SPA27252