CAS 3673-53-8

4-(4-aminophenyl)-1,3-thiazol-2-amine

Description:

4-(4-Aminophenyl)-1,3-thiazol-2-amine, also known by its CAS number 3673-53-8, is an organic compound characterized by its thiazole and aniline functional groups. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms, and an amino group (-NH2) attached to a phenyl ring. The presence of the amino group contributes to its potential as a building block in pharmaceuticals and agrochemicals, as it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The thiazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry. Additionally, its solubility and stability can vary depending on the pH and solvent conditions, which are important factors to consider in its application. Overall, 4-(4-aminophenyl)-1,3-thiazol-2-amine exhibits properties that make it a valuable compound for further research and development in various chemical and biological fields.

Formula: C₉H₉N₃S

InChI: InChI=1/C9H9N3S/c10-7-3-1-6(2-4-7)8-5-13-9(11)12-8/h1-5H,10H2,(H2,11,12)

SMILES: c1cc(ccc1c1csc(=N)[nH]1)N

Synonyms:

• 2-Thiazolamine, 4-(4-aminophenyl)-
• 4-(4-Amino-phenyl)-thiazol-2-ylamine

4-(4-Aminophenyl)Thiazol-2-Amine

CAS: 3673-53-8

4-(4-Aminophenyl)Thiazol-2-Amine

Purity: 97%

Molecular weight: 191.25g/mol

Ref: 54-OR1011123

4-(4-Amino-phenyl)-thiazol-2-ylamine

CAS: 3673-53-8

Formula: C₉H₉N₃S

Purity: 97%

Molecular weight: 191.25

Ref: 10-F031034