CymitQuimica logo

CAS 36744-59-9

:

methyl bicyclo[4.1.0]heptane-7-carboxylate

Description:
Methyl bicyclo[4.1.0]heptane-7-carboxylate is an organic compound characterized by its bicyclic structure, which consists of a seven-membered ring system with a carboxylate functional group and a methyl ester. This compound features a unique bicyclic framework that contributes to its chemical properties, including its reactivity and potential applications in organic synthesis. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Additionally, the bicyclic structure may influence its physical properties, such as boiling point and solubility, making it of interest in fields like medicinal chemistry and materials science. The compound's CAS number, 36744-59-9, serves as a unique identifier, facilitating its recognition in chemical databases and literature. Overall, methyl bicyclo[4.1.0]heptane-7-carboxylate exemplifies the complexity and diversity of organic compounds, showcasing the interplay between structure and function in chemical reactivity and application.
Formula:C9H14O2
InChI:InChI=1/C9H14O2/c1-11-9(10)8-6-4-2-3-5-7(6)8/h6-8H,2-5H2,1H3
SMILES:COC(=O)C1C2CCCCC12
Synonyms:
  • Bicyclo[4.1.0]Heptane-7-Carboxylic Acid, Methyl Ester
Found 0 products.