CAS 36746-26-6

6-amino-5-nitropyrimidin-4(1H)-one

Description:

6-Amino-5-nitropyrimidin-4(1H)-one is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both amino and nitro functional groups. The presence of the amino group at the 6-position and the nitro group at the 5-position contributes to its reactivity and potential applications in pharmaceuticals and agrochemicals. This compound typically exhibits properties such as moderate solubility in polar solvents and stability under standard conditions, although it may be sensitive to strong acids or bases. Its molecular structure allows for various chemical modifications, making it a valuable intermediate in synthetic organic chemistry. Additionally, the compound may display biological activity, which can be explored for potential therapeutic uses. As with many nitro-containing compounds, care should be taken regarding its handling and storage due to possible toxicity or environmental concerns. Overall, 6-amino-5-nitropyrimidin-4(1H)-one is an important compound in the field of medicinal chemistry and materials science.

Formula: C₄H₄N₄O₃

InChI: InChI=1/C4H4N4O3/c5-3-2(8(10)11)4(9)7-1-6-3/h1H,(H3,5,6,7,9)

SMILES: c1nc(c(c(n1)O)N(=O)=O)N

Synonyms:

• 4(3H)-pyrimidinone, 6-amino-5-nitro-
• 4-Pyrimidinol, 6-Amino-5-Nitro-
• 6-Amino-5-nitropyrimidin-4(3H)-one
• 6-Amino-5-nitropyrimidin-4-ol