CAS 3675-31-8

cyclohex-2-en-1-ylacetic acid

Description:

Cyclohex-2-en-1-ylacetic acid, with the CAS number 3675-31-8, is an organic compound characterized by its cyclohexene ring structure, which features a double bond at the 2-position and an acetic acid functional group at the 1-position. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive odor. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the carboxylic acid group. The presence of the double bond in the cyclohexene ring contributes to its reactivity, making it a potential candidate for various chemical reactions, including polymerization and addition reactions. Cyclohex-2-en-1-ylacetic acid may also exhibit biological activity, which can be of interest in medicinal chemistry and agrochemicals. Its structural features allow for potential applications in the synthesis of more complex organic molecules, making it a valuable compound in organic synthesis and industrial chemistry.

Formula: C₈H₁₂O₂

InChI: InChI=1/C8H12O2/c9-8(10)6-7-4-2-1-3-5-7/h2,4,7H,1,3,5-6H2,(H,9,10)

SMILES: C1C=CC(CC1)CC(=O)O

2-(Cyclohex-2-en-1-yl)acetic acid

CAS: 3675-31-8

Formula: C₈H₁₂O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 140.1797

Ref: IN-DA01AFR2

2-(Cyclohex-2-en-1-yl)acetic acid

CAS: 3675-31-8

2-(Cyclohex-2-en-1-yl)acetic acid

Purity: 97%

Molecular weight: 140.18g/mol

Ref: 54-OR1069334

2-(Cyclohex-2-en-1-yl)acetic acid

CAS: 3675-31-8

Versatile small molecule scaffold

Formula: C₈H₁₂O₂

Purity: Min. 95%

Molecular weight: 140.18 g/mol

Ref: 3D-DAA67531