CAS 36752-54-2
:[10]-Shogaol
Description:
[10]-Shogaol is a bioactive compound primarily found in ginger (Zingiber officinale) and is known for its potential health benefits. It is a phenolic compound and a derivative of gingerol, formed through the dehydration of gingerol during the drying process of ginger. This compound exhibits a range of biological activities, including anti-inflammatory, antioxidant, and anticancer properties. [10]-Shogaol is characterized by its pungent flavor and aroma, which contribute to the distinctive taste of ginger. It is soluble in organic solvents and has limited solubility in water. The compound has been studied for its effects on various cellular pathways, suggesting potential therapeutic applications in conditions such as cancer, metabolic disorders, and gastrointestinal issues. Additionally, [10]-Shogaol may enhance the bioavailability of other compounds and has been investigated for its role in promoting digestive health. Overall, its unique chemical structure and diverse biological activities make [10]-Shogaol a subject of interest in both food science and medicinal research.
Formula:C21H32O3
InChI:InChI=1S/C21H32O3/c1-3-4-5-6-7-8-9-10-11-12-19(22)15-13-18-14-16-20(23)21(17-18)24-2/h11-12,14,16-17,23H,3-10,13,15H2,1-2H3
InChI key:InChIKey=FADFGCOCHHNRHF-UHFFFAOYSA-N
SMILES:C(CC(C=CCCCCCCCCC)=O)C1=CC(OC)=C(O)C=C1
Synonyms:- 1-(4-Hydroxy-3-methoxyphenyl)-4-tetradecen-3-one
- 4-Tetradecen-3-one, 1-(4-hydroxy-3-methoxyphenyl)-
- 4-tetradecen-3-one, 1-(4-hydroxy-3-methoxyphenyl)-, (4E)-
- [10]-Shogaol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
10-Shogaol
CAS:10-Shogaol, as an antioxidant for human skin cell growth and a migration enhancer with potential to be a novel wound repair agent.8- and 10-Shogaol have similar metabolic profiles to -shogaol and exhibit similar toxicity toward human colon cancer cells.Formula:C21H32O3Purity:95%~99%Color and Shape:OilMolecular weight:332.484[10]-Shogaol
CAS:[10]-Shogaol (10-Shogaol) is an extract from ginger displaying antioxidant activity. It also may contain hypolipidemic and insulin-sensitizing effects.Formula:C21H32O3Purity:97.64% - 98.65%Color and Shape:SolidMolecular weight:332.4810-shogaol
CAS:Ketone with other oxygen functionsFormula:C21H32O3Purity:≥ 90.0 % (HPLC)Color and Shape:Viscous liquidMolecular weight:332.4810-Shogaol
CAS:10-Shogaol is a bioactive compound, which is a derivative of gingerol found predominantly in dried ginger (Zingiber officinale). It is an aliphatic ketone that forms through the dehydration of gingerols during thermal processing or prolonged storage, thus increasing in concentration as the ginger dries. This compound is structurally characterized by an alkyl chain attached to an aromatic ring, which contributes to its notable chemical activity.Purity:Min. 95%








