CAS 36754-60-6
:2-(chloromethyl)-1-benzofuran
Description:
2-(Chloromethyl)-1-benzofuran is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. The presence of a chloromethyl group (-CH2Cl) at the 2-position of the benzofuran enhances its reactivity, making it a useful intermediate in organic synthesis. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in pharmaceuticals and agrochemicals due to its ability to undergo various chemical reactions, such as nucleophilic substitution and coupling reactions. The compound is moderately soluble in organic solvents, and its reactivity can be influenced by the presence of the chlorine atom, which can participate in further chemical transformations. Safety precautions should be taken when handling this substance, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled. Proper storage and disposal methods are essential to mitigate environmental impact.
Formula:C9H7ClO
InChI:InChI=1/C9H7ClO/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-5H,6H2
SMILES:c1ccc2c(c1)cc(CCl)o2
Synonyms:- 2-Chloromethylbenzofuran
- Benzofuran, 2-(Chloromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(Chloromethyl)-1-benzofuran
CAS:2-(Chloromethyl)-1-benzofuran is a type of inhibitor that binds to the enzyme methanol dehydrogenase (MDH) and prevents it from forming formaldehyde. This agent has been shown to have a high oral bioavailability in rats, which is likely due to its low molecular weight and hydrophilicity. 2-(Chloromethyl)-1-benzofuran also inhibits the production of matrix metalloproteinases (MMPs), which are enzymes involved in cartilage degradation. It has been shown to be an orally bioavailable inhibitor with a kinetic profile similar to benzene, but without the carcinogenic properties.
2-(Chloromethyl)-1-benzofuran has also been shown to be effective for treating osteoarthritis in bovine models at concentrations of 10 μM or greater.Formula:C9H7ClOPurity:Min. 95%Molecular weight:166.6 g/molRef: 3D-LBA75460
Discontinued product

