CymitQuimica logo

CAS 36758-77-7

:

(2E)-3-(dimethylamino)-2-(4-methoxyphenyl)prop-2-enenitrile

Description:
(2E)-3-(Dimethylamino)-2-(4-methoxyphenyl)prop-2-enenitrile, with the CAS number 36758-77-7, is an organic compound characterized by its unique structural features. It contains a prop-2-enenitrile backbone, which is a conjugated system that contributes to its reactivity and potential applications in organic synthesis. The presence of a dimethylamino group enhances its basicity and can influence its interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the 4-methoxyphenyl substituent introduces an aromatic character, which can affect the compound's electronic properties and solubility. This compound may exhibit various physical properties, such as a specific melting point and solubility in organic solvents, which are typical for similar organic nitriles. Its reactivity can be attributed to the presence of both the nitrile and the double bond, allowing for potential participation in nucleophilic addition reactions or polymerization processes. Overall, this compound's unique structure suggests potential utility in various chemical applications, including pharmaceuticals and agrochemicals.
Formula:C12H14N2O
InChI:InChI=1/C12H14N2O/c1-14(2)9-11(8-13)10-4-6-12(15-3)7-5-10/h4-7,9H,1-3H3/b11-9-
SMILES:CN(C)/C=C(/C#N)\c1ccc(cc1)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.