CAS 36770-50-0
:3-(2-Pyridyl)-5-(4-pyridyl)-1,2,4-triazole
Description:
3-(2-Pyridyl)-5-(4-pyridyl)-1,2,4-triazole is a heterocyclic compound characterized by its triazole ring, which is a five-membered ring containing three nitrogen atoms and two carbon atoms. This compound features two pyridine substituents at the 3 and 5 positions of the triazole ring, contributing to its potential biological activity and solubility properties. The presence of nitrogen atoms in both the triazole and pyridine rings enhances its ability to form hydrogen bonds, making it a candidate for various applications in medicinal chemistry and agrochemicals. It may exhibit antifungal, antibacterial, or herbicidal properties, depending on its specific interactions with biological targets. The compound is typically synthesized through multi-step organic reactions, and its stability and reactivity can be influenced by the electronic effects of the pyridine groups. Additionally, its solubility in organic solvents and water can vary, affecting its utility in different formulations. Overall, 3-(2-Pyridyl)-5-(4-pyridyl)-1,2,4-triazole is of interest for its potential applications in pharmaceuticals and crop protection.
Formula:C12H9N5
InChI:InChI=1/C12H9N5/c1-2-6-14-10(3-1)12-15-11(16-17-12)9-4-7-13-8-5-9/h1-8H,(H,15,16,17)
SMILES:c1ccnc(c1)c1nc(c2ccncc2)n[nH]1
Synonyms:- 2-[3-(4-pyridyl)-1H-1,2,4-triazol-5-yl]pyridine
- 2-[3-(Pyridin-4-yl)-1H-1,2,4-triazol-5-yl]pyridine
- pyridine, 2-[3-(4-pyridinyl)-1H-1,2,4-triazol-5-yl]-
- pyridine, 2-[5-(4-pyridinyl)-1H-1,2,4-triazol-3-yl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(2-Pyridyl)-5-(4-pyridyl)-1,2,4-triazole, 99%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C12H9N5Purity:99%Molecular weight:223.242-(3-(Pyridin-4-yl)-1H-1,2,4-triazol-5-yl)pyridine
CAS:<p>2-(3-(Pyridin-4-yl)-1H-1,2,4-triazol-5-yl)pyridine</p>Purity:99%Molecular weight:223.23g/mol



