
CAS 36774-74-0
:2-Phenyl-5-benzothiazoleacetic acid
Description:
2-Phenyl-5-benzothiazoleacetic acid is an organic compound characterized by its unique structure, which includes a benzothiazole moiety and a phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in various fields, including pharmaceuticals and materials science. It is generally a solid at room temperature and may have moderate solubility in organic solvents, while its solubility in water can vary. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may act as a weak acid. Additionally, the compound may exhibit biological activity, making it of interest for medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could lead to various therapeutic applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H11NO2S
InChI:InChI=1S/C15H11NO2S/c17-14(18)9-10-6-7-13-12(8-10)16-15(19-13)11-4-2-1-3-5-11/h1-8H,9H2,(H,17,18)
InChI key:InChIKey=CGJFGPQHBSLGOO-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=C2C(SC(=N2)C3=CC=CC=C3)=CC1
Synonyms:- 2-Phenyl-5-benzothiazolylacetic acid
- K 308
- 2-Phenyl-5-benzothiazoleacetic acid
- 2-(2-Phenylbenzo[d]thiazol-5-yl)acetic acid
- 5-Benzothiazoleacetic acid, 2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
K 308
CAS:K 308 is a bioactive chemical.Formula:C15H11NO2SColor and Shape:SolidMolecular weight:269.32
