CymitQuimica logo

CAS 36778-15-1

:

5-nitro-1,2-thiazole-3-carboxylic acid

Description:
5-Nitro-1,2-thiazole-3-carboxylic acid is a heterocyclic organic compound characterized by the presence of a thiazole ring, a nitro group, and a carboxylic acid functional group. The thiazole ring contributes to its aromatic properties and potential reactivity, while the nitro group is known for its electron-withdrawing effects, which can influence the compound's reactivity and stability. The carboxylic acid group imparts acidic characteristics, allowing the compound to participate in various chemical reactions, such as esterification or amidation. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its solubility and stability can vary depending on the solvent and environmental conditions. Additionally, the presence of the nitro group may confer specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as nitro compounds can pose health risks. Overall, 5-nitro-1,2-thiazole-3-carboxylic acid is a versatile compound with significant implications in chemical research and application.
Formula:C4H2N2O4S
InChI:InChI=1/C4H2N2O4S/c7-4(8)2-1-3(6(9)10)11-5-2/h1H,(H,7,8)
InChI key:VYNSNKZEWKFVJN-UHFFFAOYSA-N
SMILES:C1=C(SN=C1C(=O)O)[N+](=O)[O-]
Synonyms:
  • acide 5-nitro-1,2-thiazole-3-carboxylique
Found 4 products.