CymitQuimica logo

CAS 368-67-2

:

1-Ethoxy-3,5-bis(trifluoromethyl)benzene

Description:
1-Ethoxy-3,5-bis(trifluoromethyl)benzene, with the CAS number 368-67-2, is an aromatic compound characterized by the presence of an ethoxy group and two trifluoromethyl groups attached to a benzene ring. This compound typically exhibits a colorless to pale yellow liquid form and is known for its distinctive chemical properties, including high stability and low reactivity due to the electron-withdrawing nature of the trifluoromethyl groups. The presence of these groups significantly influences its physical properties, such as increasing the compound's lipophilicity and altering its boiling and melting points compared to non-fluorinated analogs. Additionally, 1-ethoxy-3,5-bis(trifluoromethyl)benzene is often utilized in various chemical syntheses and research applications, particularly in the development of pharmaceuticals and agrochemicals. Its unique structure allows for potential applications in materials science and as a building block in organic synthesis. Safety data should be consulted for handling and storage, as fluorinated compounds can pose specific health and environmental risks.
Formula:C10H8F6O
InChI:InChI=1S/C10H8F6O/c1-2-17-8-4-6(9(11,12)13)3-7(5-8)10(14,15)16/h3-5H,2H2,1H3
InChI key:InChIKey=NAUCMEORLXGXLA-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C(F)(F)F)=CC(OCC)=C1
Synonyms:
  • Benzene, 1-ethoxy-3,5-bis(trifluoromethyl)-
  • 3,5-Bis(trifluoromethyl)ethoxybenzene
  • Phenetole, 3,5-bis(trifluoromethyl)-
  • 1-Ethoxy-3,5-bis(trifluoromethyl)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.