CAS 3680-32-8
:2',4,6-trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione
Description:
2',4,6-Trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione, with CAS number 3680-32-8, is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of benzofuran and cyclohexene. This compound features multiple methoxy groups, which are known to enhance solubility and influence reactivity due to their electron-donating properties. The presence of the dione functional groups indicates that it may exhibit keto-enol tautomerism, potentially affecting its chemical behavior and stability. Additionally, the spiro arrangement contributes to its three-dimensional conformation, which can impact its biological activity and interactions with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their diverse chemical properties. Understanding the characteristics of this compound can provide insights into its reactivity, potential uses, and the mechanisms by which it may exert biological effects.
Formula:C17H18O6
InChI:InChI=1/C17H18O6/c1-9-5-10(18)6-14(22-4)17(9)16(19)15-12(21-3)7-11(20-2)8-13(15)23-17/h6-9H,5H2,1-4H3
SMILES:CC1CC(=O)C=C(C21C(=O)c1c(cc(cc1O2)OC)OC)OC
Synonyms:- 2',4,6-Trimethoxy-6'-methylspiro(benzofuran-2(3H),1'-(2)cyclohexene)-3,4'-dione
- Spiro(benzofuran-2(3H),1'-(2)cyclohexene)-3,4'-dione, 2',4,6-trimethoxy-6'-methyl-
- spiro[benzofuran-2(3H),1'-cyclohex[2]ene]-3,4'-dione, 2',4,6-trimethoxy-6'-methyl-
- 2',4,6-Trimethoxy-6'-methyl-3H,4'H-spiro[1-benzofuran-2,1'-cyclohex[2]ene]-3,4'-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Griseofulvin EP Impurity B (Dechloro Griseofulvin)
CAS:Formula:C17H18O6Color and Shape:Off-White SolidMolecular weight:318.33Dechlorogriseofulvin
CAS:Dechlorogriseofulvin is a useful organic compound for research related to life sciences. The catalog number is T124937 and the CAS number is 3680-32-8.Formula:C17H18O6Color and Shape:SolidMolecular weight:318.3257-Dechloro Griseofulvin
CAS:Controlled ProductApplications A major photoproduct (impurity) of Griseofulvin (G787500).
References Mantle, P., et al.: J. Gen. Microbiol., 130, 1293 (1984), Boonphong, S., et al.: J. Nat. Prod., 64, 965 (2001),Formula:C17H18O6Color and Shape:NeatMolecular weight:318.32



