CAS 3680-41-9

1-(2-bromophenoxy)-3-pyrrolidin-1-ylpropan-2-ol

Description:

1-(2-Bromophenoxy)-3-pyrrolidin-1-ylpropan-2-ol, with the CAS number 3680-41-9, is a chemical compound characterized by its complex structure that includes a bromophenyl group, a pyrrolidine moiety, and a secondary alcohol. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its solubility and reactivity. The presence of the bromine atom introduces a halogen, which can enhance the compound's electrophilic character, making it potentially reactive in various chemical reactions. The pyrrolidine ring contributes to its basicity and can participate in hydrogen bonding, affecting its interactions with biological systems. Additionally, the alcohol functional group may impart hydrophilicity, influencing its solubility in polar solvents. Overall, this compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities or uses would depend on further research and context.

Formula: C₁₃H₁₈BrNO₂

InChI: InChI=1/C13H18BrNO2/c14-12-5-1-2-6-13(12)17-10-11(16)9-15-7-3-4-8-15/h1-2,5-6,11,16H,3-4,7-10H2

SMILES: c1ccc(c(c1)Br)OCC(CN1CCCC1)O

1-(2-bromophenoxy)-3-pyrrolidin-1-ylpropan-2-ol

CAS: 3680-41-9

Formula: C₁₃H₁₈BrNO₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 300.196

Ref: 10-F315193