CAS 36804-17-8: (2R,3R)-3,5,7-trihydroxy-2-[3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydro-4H-chromen-4-one
Description:The chemical substance known as "(2R,3R)-3,5,7-trihydroxy-2-[3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydro-4H-chromen-4-one," with the CAS number 36804-17-8, is a complex organic compound characterized by its polyphenolic structure. It features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of a chromone moiety indicates that it may exhibit biological activities, including anti-inflammatory and antimicrobial effects. The compound's intricate structure includes a benzodioxin unit, which may enhance its interaction with biological targets. Its stereochemistry, denoted by the (2R,3R) configuration, suggests specific spatial arrangements that could influence its reactivity and biological activity. This compound is of interest in medicinal chemistry and natural product research, particularly for its potential therapeutic applications. Overall, its unique structural features and functional groups make it a subject of study for various pharmacological properties.
Formula:C25H22O10
InChI:InChI=1/C25H22O10/c1-32-17-6-11(2-4-14(17)28)24-20(10-26)33-16-5-3-12(7-18(16)34-24)25-23(31)22(30)21-15(29)8-13(27)9-19(21)35-25/h2-9,20,23-29,31H,10H2,1H3/t20?,23-,24?,25+/m0/s1
- Synonyms:
- 4H-1-benzopyran-4-one, 2-[2,3-dihydro-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-, (2R,3R)-