
CAS 36826-66-1
:(3R,4S,5S,7R,9E,11R,12R)-12-Ethyl-3,5,7,11-tetramethyl-4-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]oxacyclododec-9-ene-2,8-dione
Description:
The chemical substance with the name "(3R,4S,5S,7R,9E,11R,12R)-12-Ethyl-3,5,7,11-tetramethyl-4-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]oxacyclododec-9-ene-2,8-dione" and CAS number "36826-66-1" is a complex organic compound characterized by its intricate stereochemistry and functional groups. It features multiple chiral centers, indicating that it exists in specific stereoisomeric forms, which can significantly influence its biological activity and interactions. The presence of a dimethylamino group suggests potential for biological activity, possibly as a pharmacophore. The oxacyclododec-9-ene structure indicates a cyclic component, which may contribute to its stability and reactivity. Additionally, the presence of a sugar moiety (trideoxy-β-D-xylo-hexopyranosyl) suggests that this compound may have glycosidic properties, potentially influencing its solubility and interaction with biological systems. Overall, this compound's unique structure may confer specific properties that could be of interest in medicinal chemistry or biochemistry.
Formula:C25H43NO6
InChI:InChI=1S/C25H43NO6/c1-9-21-14(2)10-11-20(27)15(3)12-16(4)23(18(6)24(29)31-21)32-25-22(28)19(26(7)8)13-17(5)30-25/h10-11,14-19,21-23,25,28H,9,12-13H2,1-8H3/b11-10+/t14-,15-,16+,17-,18-,19+,21-,22-,23+,25+/m1/s1
InChI key:InChIKey=DZGHWPQKGWXOHD-NHLONWFASA-N
SMILES:O([C@H]1[C@H](O)[C@@H](N(C)C)C[C@@H](C)O1)[C@@H]2[C@@H](C)C(=O)O[C@H](CC)[C@H](C)\C=C\C(=O)[C@H](C)C[C@@H]2C
Synonyms:- Methymycin, 10-deoxy-
- Oxacyclododecane, methymycin deriv.
- Antibiotic YC-17
- YC-17
- Oxacyclododec-9-ene-2,8-dione, 12-ethyl-3,5,7,11-tetramethyl-4-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]-, (3R,4S,5S,7R,9E,11R,12R)-
- 10-Deoxymethymycin
- (3R,4S,5S,7R,9E,11R,12R)-12-Ethyl-3,5,7,11-tetramethyl-4-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]oxacyclododec-9-ene-2,8-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
10-Deoxymethymycin
CAS:10-Deoxymethymycin (AntibioticYC 17) exhibits antibiotic activity against Gram-positive bacteria.Formula:C25H43NO6Color and Shape:SolidMolecular weight:453.612
