CAS 36842-44-1

5-Hexene-1,2-diol

Description:

5-Hexene-1,2-diol is an organic compound characterized by its structure, which features a six-carbon chain with hydroxyl (-OH) groups attached to the first and second carbon atoms. This diol is classified as an unsaturated alcohol due to the presence of a double bond between the fourth and fifth carbon atoms. Its molecular formula is C6H12O2, indicating that it contains six carbon atoms, twelve hydrogen atoms, and two oxygen atoms. The compound is typically a colorless to pale yellow liquid with a moderate viscosity and is soluble in water and organic solvents, making it versatile for various applications. 5-Hexene-1,2-diol can participate in various chemical reactions, including oxidation and polymerization, which makes it useful in the synthesis of other chemical compounds and materials. Additionally, it may exhibit properties such as hygroscopicity and reactivity towards electrophiles due to the presence of the double bond and hydroxyl groups. Safety data should be consulted for handling and potential hazards associated with this compound.

Formula: C₆H₁₂O₂

InChI: InChI=1S/C6H12O2/c1-2-3-4-6(8)5-7/h2,6-8H,1,3-5H2

InChI key: InChIKey=WGTGQGJDNAGBCC-UHFFFAOYSA-N

SMILES: C(CCC=C)(CO)O

Synonyms:

• (±)-5-Hexene-1,2-diol
• 5,6-Dihydroxy-1-hexene
• 5-Hexene-1,2-diol