CAS 368426-78-2

3-Amino-1,2-benzisoxazole-6-methanamine

Description:

3-Amino-1,2-benzisoxazole-6-methanamine, identified by its CAS number 368426-78-2, is a chemical compound that features a benzisoxazole core, which is a bicyclic structure containing both benzene and isoxazole rings. This compound possesses amino groups, which contribute to its basicity and potential reactivity in various chemical reactions. The presence of the methanamine group indicates that it has a primary amine functionality, making it capable of forming hydrogen bonds and participating in nucleophilic reactions. The molecular structure suggests that it may exhibit biological activity, potentially serving as a scaffold for drug development or as a research tool in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and solvent. Overall, 3-Amino-1,2-benzisoxazole-6-methanamine is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₈H₉N₃O

InChI: InChI=1/C8H9N3O/c9-4-5-1-2-6-7(3-5)12-11-8(6)10/h1-3H,4,9H2,(H2,10,11)

SMILES: c1cc2c(cc1CN)o[nH]c2=N

Synonyms:

• 1,2-Benzisoxazole-6-Methanamine, 3-Amino-
• 6-(Aminomethyl)-1,2-benzoxazol-3-amine

Alphadolone 3-β-D-Glucuronide

Controlled Product

CAS: 368426-78-2

Formula: C₂₇H₄₀O₁₀

Color and Shape: Neat

Molecular weight: 524.601

Ref: TR-A575515

Alphadolone 3-β-D-Glucuronide

Controlled Product

CAS: 368426-78-2

Formula: C₂₇H₄₀O₁₀

Color and Shape: Neat

Molecular weight: 524.601

Ref: TR-A296430