CymitQuimica logo

CAS 36847-86-6

:

N-(4-Bromophenyl)maleamic acid

Description:
N-(4-Bromophenyl)maleamic acid is an organic compound characterized by its maleamic acid structure, which features a maleic acid backbone modified with a 4-bromophenyl group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, including potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the carboxylic acid group. The bromine substituent on the phenyl ring can influence the compound's reactivity and stability, often enhancing its electrophilic character. N-(4-Bromophenyl)maleamic acid may also exhibit biological activity, making it of interest in pharmaceutical and materials science research. Its molecular structure allows for various chemical reactions, including amide formation and potential polymerization, which can be exploited in synthetic applications. Additionally, the compound's physical properties, such as melting point and solubility, can vary based on environmental conditions and the presence of other chemical species. Overall, N-(4-Bromophenyl)maleamic acid is a versatile compound with applications in various fields of chemistry.
Formula:C10H8BrNO3
InChI:InChI=1/C10H8BrNO3/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(14)15/h1-6H,(H,12,13)(H,14,15)/b6-5-
SMILES:c1cc(ccc1Br)NC(=O)/C=C\C(=O)O
Synonyms:
  • (2Z)-4-[(4-bromophenyl)amino]-4-oxobut-2-enoate
  • (2Z)-4-[(4-bromophenyl)amino]-4-oxobut-2-enoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.