CymitQuimica logo

CAS 3685-23-2

:

cis-4-Aminocyclohexanecarboxylic Acid

Description:
Cis-4-Aminocyclohexanecarboxylic acid, with the CAS number 3685-23-2, is an organic compound characterized by its cyclohexane ring structure, which features an amino group (-NH2) and a carboxylic acid group (-COOH) at the 4-position. This compound exists in a cis configuration, meaning that the amino and carboxylic acid groups are on the same side of the cyclohexane ring, influencing its stereochemistry and reactivity. It is a chiral molecule, which can exist in two enantiomeric forms. The presence of both functional groups makes it a versatile compound in organic synthesis and medicinal chemistry, often studied for its potential biological activities, including its role as an amino acid derivative. Its solubility in water is moderate due to the polar nature of the carboxylic acid and amino groups, and it can participate in various chemical reactions, such as amide formation and decarboxylation. Overall, cis-4-Aminocyclohexanecarboxylic acid is of interest in both academic research and potential pharmaceutical applications.
Formula:C7H13NO2
InChI:InChI=1/C7H13NO2/c8-6-3-1-5(2-4-6)7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6+
InChI key:DRNGLYHKYPNTEA-UHFFFAOYSA-N
SMILES:C1CC(CCC1C(=O)O)N
Found 9 products.