CAS 36854-57-6: α-Ethylbenzeneacetyl chloride
Description:α-Ethylbenzeneacetyl chloride, with the CAS number 36854-57-6, is an organic compound characterized by the presence of both an acyl chloride functional group and an ethylbenzene moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its strong, pungent odor, characteristic of acyl chlorides. It is reactive, particularly with water, leading to the formation of hydrochloric acid and corresponding acids upon hydrolysis. α-Ethylbenzeneacetyl chloride is utilized in organic synthesis, particularly in the preparation of various derivatives and intermediates in pharmaceuticals and agrochemicals. Its reactivity allows it to participate in acylation reactions, making it valuable in the synthesis of more complex organic molecules. Due to its reactive nature, it should be handled with care, using appropriate safety measures to avoid exposure, as it can cause irritation to the skin, eyes, and respiratory system. Proper storage in a cool, dry place, away from moisture, is essential to maintain its stability and prevent unwanted reactions.
Formula:C10H11ClO
InChI:InChI=1S/C10H11ClO/c1-2-9(10(11)12)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3
InChI key:InChIKey=QGXMHCMPIAYMGT-UHFFFAOYSA-N
SMILES:O=C(Cl)C(C=1C=CC=CC1)CC
- Synonyms:
- (2R)-2-phenylbutanoyl chloride
- (2S)-2-phenylbutanoyl chloride
- (±)-2-Phenylbutyric chloride
- (±)-α-Phenylbutyryl chloride
- 2-Phenylbutanoyl chloride
- Benzeneacetyl Chloride, Alpha-Ethyl-
- Benzeneacetyl chloride, α-ethyl-
- Butyryl chloride, 2-phenyl-
- NSC 86133
- α-Ethylbenzeneacetyl chloride
- See more synonyms
- 2-Phenylbutyryl chloride
