CAS 36855-78-4
:4-Amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide
Description:
4-Amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide is an organic compound characterized by its unique structure, which includes an amino group, a benzamide moiety, and a thiadiazole ring. The presence of the thiadiazole ring contributes to its potential biological activity, as such heterocycles are often found in pharmacologically active compounds. This substance typically exhibits moderate solubility in polar solvents due to the presence of both hydrophilic (amino and carbonyl groups) and hydrophobic (aromatic ring) components. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or anti-inflammatory agents. The compound may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. Additionally, its stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 4-Amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide represents a versatile compound with potential applications in various fields of research.
Formula:C10H10N4OS
InChI:InChI=1S/C10H10N4OS/c1-6-13-14-10(16-6)12-9(15)7-2-4-8(11)5-3-7/h2-5H,11H2,1H3,(H,12,14,15)
InChI key:InChIKey=MUMUKRNKRCYTQB-UHFFFAOYSA-N
SMILES:C(NC=1SC(C)=NN1)(=O)C2=CC=C(N)C=C2
Synonyms:- benzamide, 4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-
- 4-Amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
