CAS 36860-49-8

Ethyl 2-amino-5,6-dihydro-4H-4,7-ethanothieno[2,3-b]pyridine-3-carboxylate

Description:

Ethyl 2-amino-5,6-dihydro-4H-4,7-ethanothieno[2,3-b]pyridine-3-carboxylate, with the CAS number 36860-49-8, is a chemical compound characterized by its complex bicyclic structure that incorporates both thieno and pyridine moieties. This compound features an ethyl ester functional group, which contributes to its solubility and reactivity. The presence of an amino group indicates potential for hydrogen bonding and reactivity in various chemical reactions, making it a candidate for applications in medicinal chemistry and drug development. Its dihydro form suggests that it may exhibit specific stereochemical properties, influencing its biological activity. The thieno and pyridine rings provide a unique electronic environment, which can affect the compound's interaction with biological targets. Overall, this compound's structural features suggest it may possess interesting pharmacological properties, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₂H₁₆N₂O₂S

InChI: InChI=1S/C12H16N2O2S/c1-2-16-12(15)9-8-7-3-5-14(6-4-7)11(8)17-10(9)13/h7H,2-6,13H2,1H3

InChI key: InChIKey=VEEARKIVPVIRAK-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C2=C(N3CCC2CC3)SC1N

Synonyms:

• 4H-4,7-Ethanothieno[2,3-b]pyridine-3-carboxylic acid, 2-amino-5,6-dihydro-, ethyl ester
• Ethyl 4-amino-3-thia-1-azatricyclo[5.2.2.0~2,6~]undeca-2(6),4-diene-5-carboxylate
• Ethyl 2-amino-5,6-dihydro-4H-4,7-ethanothieno[2,3-b]pyridine-3-carboxylate

Ethyl 4-amino-3-thia-1-azatricyclo[5.2.2.0,2,6]undeca-2(6),4-diene-5-carboxylate

CAS: 36860-49-8

Ethyl 4-amino-3-thia-1-azatricyclo[5.2.2.0,2,6]undeca-2(6),4-diene-5-carboxylate is an acylated amino acid that contains a cyanoacetic acid moiety with an elemental sulfur atom in the side chain. It is used in the production of acrylamide and as a precursor to various pharmaceuticals, pesticides, and dyes.

Formula: C₁₂H₁₆N₂O₂S

Purity: Min. 95%

Molecular weight: 252.33 g/mol

Ref: 3D-LBA86049