CymitQuimica logo

CAS 3687-22-7

:

2-(1-methylheptyl)-4,6-dinitrophenol

Description:
2-(1-Methylheptyl)-4,6-dinitrophenol, with the CAS number 3687-22-7, is an organic compound characterized by its dinitrophenol structure, which features two nitro groups (-NO2) attached to a phenolic ring. This compound is a derivative of phenol, where a branched alkyl chain (1-methylheptyl) is substituted at the para position relative to the hydroxyl group. The presence of the nitro groups contributes to its potential as a strong acid and influences its reactivity and solubility in various solvents. Typically, dinitrophenols are known for their use in various applications, including as herbicides and in the synthesis of dyes and explosives. The compound may exhibit toxicological properties, necessitating careful handling and consideration of environmental impact. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific molecular structure and substituents. Overall, 2-(1-methylheptyl)-4,6-dinitrophenol represents a complex organic molecule with significant chemical reactivity and potential applications in industrial chemistry.
Formula:C14H20N2O5
InChI:InChI=1/C14H20N2O5/c1-3-4-5-6-7-10(2)12-8-11(15(18)19)9-13(14(12)17)16(20)21/h8-10,17H,3-7H2,1-2H3
InChI key:InChIKey=DVOCCVCLRHDYOB-UHFFFAOYSA-N
SMILES:C(CCCCCC)(C)C1=C(O)C(N(=O)=O)=CC(N(=O)=O)=C1
Synonyms:
  • 2,4-Dinitro-6-(1-Methylheptyl)Phenol
  • 2,4-Dnop
  • 2-(2-Hydroxy-3,5-dinitrophenyl)octane
  • Phenol, 2-(1-methylheptyl)-4,6-dinitro-
  • 2-(1-Methylheptyl)-4,6-dinitrophenol
  • DNOP
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.