CymitQuimica logo

CAS 36871-55-3

:

1-(4-Chloro-2-methoxyphenyl)-1-propanone

Description:
1-(4-Chloro-2-methoxyphenyl)-1-propanone, with the CAS number 36871-55-3, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. This compound features a propanone moiety attached to a phenyl group that is further substituted with a chlorine atom and a methoxy group. The presence of the chlorine atom typically imparts increased reactivity and can influence the compound's biological activity, while the methoxy group may enhance solubility in organic solvents. The molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of the functional groups present. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound exemplifies the complexity and utility of substituted aromatic ketones in various chemical applications.
Formula:C10H11ClO2
InChI:InChI=1S/C10H11ClO2/c1-3-9(12)8-5-4-7(11)6-10(8)13-2/h4-6H,3H2,1-2H3
InChI key:InChIKey=PELVKTMDDXVZAT-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=C(OC)C=C(Cl)C=C1
Synonyms:
  • 1-(4-Chloro-2-methoxyphenyl)-1-propanone
  • 1-Propanone, 1-(4-chloro-2-methoxyphenyl)-
Found 4 products.