CAS 36874-53-0
:1-(1,3-benzothiazol-2-yl)propan-2-one
Description:
1-(1,3-benzothiazol-2-yl)propan-2-one, with the CAS number 36874-53-0, is an organic compound characterized by its unique structure that includes a benzothiazole moiety and a ketone functional group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the benzothiazole ring contributes to its biological activity, making it of interest in medicinal chemistry for its potential antimicrobial or anticancer properties. The ketone group in the propan-2-one structure can participate in various chemical reactions, such as nucleophilic additions. Additionally, this compound may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations for its handling and application in research and industrial processes.
Formula:C10H9NOS
InChI:InChI=1/C10H9NOS/c1-7(12)6-10-11-8-4-2-3-5-9(8)13-10/h2-5H,6H2,1H3
SMILES:CC(=O)Cc1nc2ccccc2s1
Synonyms:- 1-(1,3-Benzothiazol-2-yl)acetone
- 2-Propanone, 1-(2-Benzothiazolyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-(1,3-Benzothiazol-2-yl)propan-2-one
CAS:1-(1,3-Benzothiazol-2-yl)propan-2-one is a type of benzene compound with substituent groups. It has the formula CHCHS. The substituents are methyl and acetate. The benzene ring is substituted with two substituents in the coplanar arrangement. Benzene rings can form condensation products through a process called electrophilic substitution. This process involves the addition of an electron pair to an atom or molecule by an electrophile to form a covalent bond. One example of this reaction is the formation of methyl acetate from 1-(1,3-benzothiazol-2-yl)propan-2-one by heating it with methanol.
Formula:C10H9NOSPurity:Min. 95%Molecular weight:191.25 g/mol
