CAS 36877-69-7
:rhodamine B isothiocyanate
Description:
Rhodamine B isothiocyanate is a synthetic dye and a derivative of rhodamine B, characterized by its vibrant pink to red color. It is primarily used as a fluorescent marker in biological and chemical applications due to its strong fluorescence properties. The compound features an isothiocyanate functional group, which enhances its reactivity, allowing it to form covalent bonds with amino groups in proteins, making it useful for labeling biomolecules in various assays. Rhodamine B isothiocyanate is soluble in organic solvents and exhibits stability under a range of conditions, although it can be sensitive to light and may degrade over time. Its fluorescence can be excited by specific wavelengths of light, making it valuable in microscopy and flow cytometry. Safety considerations include handling it with care, as it may pose health risks upon exposure, including potential skin and eye irritation. Overall, rhodamine B isothiocyanate is a versatile tool in research and diagnostic applications, particularly in the fields of biochemistry and molecular biology.
Formula:C29H29N3O3S
InChI:InChI=1/C29H29N3O3S/c1-5-31(6-2)20-10-13-23-26(16-20)34-27-17-21(32(7-3)8-4)11-14-24(27)29(23)25-15-19(30-18-36)9-12-22(25)28(33)35-29/h9-17H,5-8H2,1-4H3
SMILES:CCN(CC)c1ccc2c(c1)Oc1cc(ccc1C12c2cc(ccc2C(=O)O1)N=C=S)N(CC)CC
Synonyms:- 3',6'-bis(diethylamino)-6-isothiocyanato-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one
- Ethanaminium, N-[9-[2-carboxy-5(or 6)-isothiocyanatophenyl]-6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethyl-, chloride
- Rhodamine�B isothiocyanate
- Xanthylium, 9-[2-carboxy-5(or 6)-isothiocyanatophenyl]-3,6-bis(diethylamino)-, chloride
- Xanthylium, 9-[2-carboxy-5(or 6)-isothiocyanatophenyl]-3,6-bis(diethylamino)-, chloride (1:1)
- [9-(2-Carboxyisothiocyanatophenyl)-6-(diethylamino)-3H-xanthen-3-ylidene]diethylammonium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
RBITC [Rhodamine B 5-isothiocyanate]
CAS:Rhodamine B isothiocyanate is a mixture of isomers for fluorescence applications including fluorescent marking of proteins. It is derivatite of phenolphtalein.Formula:C29H30ClN3O3SPurity:98%Color and Shape:SolidMolecular weight:536.08Rhodamine B isothiocyanate, mixture of isomers
CAS:Rhodamine B isothiocyanate (RBITC) is a fluorescent dye that can be synthesized by reacting 2,4-dinitrobenzene with aniline. RBITC fluoresces in the visible spectrum, but has also been shown to fluoresce in the near infrared region of the electromagnetic spectrum. The microstructural and morphological properties of RBITC have been studied using simulations methods such as molecular dynamics and Monte Carlo techniques. RBITC has a spinodal decomposition behavior when heated or cooled, which can be used to study transport pathways in solids. These pathways are motivated by connectivity and topological techniques.
Formula:C29H30N3O3SClPurity:Min. 70%Color and Shape:Red PowderMolecular weight:536.09 g/mol



