CAS 368869-86-7

1-(4-Iodophenyl)-1H-pyrazole

Description:

1-(4-Iodophenyl)-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two adjacent nitrogen atoms. The presence of a 4-iodophenyl group indicates that an iodine atom is substituted on the phenyl ring at the para position relative to the pyrazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the iodine substituent, which can participate in various chemical reactions, including nucleophilic substitutions. The compound may also display biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure contributes to its unique physical and chemical properties, which can include specific melting and boiling points, as well as distinct spectral characteristics in techniques like NMR and IR spectroscopy. Overall, 1-(4-Iodophenyl)-1H-pyrazole serves as a valuable building block in synthetic organic chemistry and may have applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₇IN₂

InChI: InChI=1S/C9H7IN2/c10-8-2-4-9(5-3-8)12-7-1-6-11-12/h1-7H

InChI key: InChIKey=ADIQBEMLKKKISJ-UHFFFAOYSA-N

SMILES: IC1=CC=C(C=C1)N2C=CC=N2

Synonyms:

• 1H-Pyrazole, 1-(4-iodophenyl)-
• 1-(4-Iodophenyl)pyrazole
• 1-(4-Iodophenyl)-1H-pyrazole

1-(4-Iodophenyl)-1H-pyrazole

CAS: 368869-86-7

Formula: C₉H₇IN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 270.0697

Ref: IN-DA00BXL7

1-(4-Iodophenyl)-1H-pyrazole

CAS: 368869-86-7

1-(4-Iodophenyl)-1H-pyrazole

Purity: ≥95%

Color and Shape: Pale Yellow Solid

Molecular weight: 270.07g/mol

Ref: 54-OR23295

1-(4-Iodophenyl)-1H-pyrazole

CAS: 368869-86-7

Formula: C₉H₇IN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 270.073

Ref: 10-F067207

1-(4-Iodophenyl)-1H-pyrazole

CAS: 368869-86-7

1-(4-Iodophenyl)-1H-pyrazole is a bromoarene that can be synthesized by iodination of 1-(4-iodophenyl)ethanone. The compound is an example of a high yielding synthesis and has been shown to undergo homocoupling reactions with various functional groups, such as carbonyls, hydroxyls, and organotrifluoroborates. This compound is also useful for the synthesis of potassium derivatives.

Formula: C₉H₇IN₂

Purity: Min. 95%

Molecular weight: 270.07 g/mol

Ref: 3D-TPA86986