CAS 36889-15-3
:Gentamicin B
Description:
Gentamicin B is an aminoglycoside antibiotic that is primarily used to treat various bacterial infections, particularly those caused by Gram-negative bacteria. It is derived from the bacterium Micromonospora purpurea and is part of a broader group of gentamicins, which also includes gentamicin C and gentamicin A. The chemical structure of Gentamicin B features multiple amino groups, which contribute to its mechanism of action by binding to the bacterial ribosome, inhibiting protein synthesis, and ultimately leading to cell death. It is typically administered via injection due to its poor oral bioavailability. Gentamicin B exhibits a broad spectrum of activity against a range of pathogens, making it effective in treating serious infections, including those in immunocompromised patients. However, its use is associated with potential nephrotoxicity and ototoxicity, necessitating careful monitoring of kidney function and hearing during treatment. As with other antibiotics, the emergence of resistance is a concern, highlighting the importance of appropriate use in clinical settings.
Formula:C19H38N4O10
InChI:InChI=1S/C19H38N4O10/c1-19(29)5-30-17(13(28)16(19)23-2)32-14-6(21)3-7(22)15(12(14)27)33-18-11(26)10(25)9(24)8(4-20)31-18/h6-18,23-29H,3-5,20-22H2,1-2H3/t6-,7+,8-,9-,10+,11-,12-,13-,14+,15-,16-,17-,18-,19+/m1/s1
InChI key:InChIKey=RHRAMPXHWHSKQB-GGEUKFTFSA-N
SMILES:O([C@H]1[C@H](O)[C@@H](O[C@@H]2[C@H](O)[C@@H](NC)[C@@](C)(O)CO2)[C@H](N)C[C@@H]1N)[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3O
Synonyms:- (1R,2R,3S,4R,6S)-4,6-diamino-3-{[3-deoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranosyl]oxy}-2-hydroxycyclohexyl 6-amino-6-deoxy-α-D-glucopyranoside
- 4,6-diamino-3-{[3-deoxy-4-C-methyl-3-(methylamino)pentopyranosyl]oxy}-2-hydroxycyclohexyl 6-amino-6-deoxyhexopyranoside
- <span class="text-smallcaps">D</smallcap>-Streptamine, O-6-amino-6-deoxy-α-<smallcap>D</smallcap>-glucopyranosyl-(1→4)-O-[3-deoxy-4-C-methyl-3-(methylamino)-β-<smallcap>L</span>-arabinopyranosyl-(1→6)]-2-deoxy-
- Betamicin [INN]
- Betamicina
- Betamicina [INN-Spanish]
- Betamicine
- Betamicine [INN-French]
- Betamicinum
- Betamicinum [INN-Latin]
- D-Streptamine, O-6-amino-6-deoxy-alpha-D-glucopyranosyl-(1-4)-O-(3-deoxy-4-C-methyl-3-(methylamino)-beta-L-arabinopyranosyl-(1-6))-2-deoxy-
- Gentamicin B
- Gentamycin B
- O-6-Amino-6-deoxy-alpha-D-glucopyranosyl-(1-4)-O-(3-deoxy-4-C-methyl-3-(methylamino)-beta-L-arabinopyranosyl-(1-6))-2-deoxy-D-streptamine
- O-6-Amino-6-deoxy-α-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-(1→4)-O-[3-deoxy-4-C-methyl-3-(methylamino)-β-<smallcap>L</smallcap>-arabinopyranosyl-(1→6)]-2-deoxy-<smallcap>D</span>-streptamine
- Sch 14342
- Unii-67W9Dgg4C7
- D-Streptamine, O-6-amino-6-deoxy-α-D-glucopyranosyl-(1→4)-O-[3-deoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranosyl-(1→6)]-2-deoxy-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Gentamicin B
CAS:Gentamicin B is an aminoglycoside antibiotic, which is derived from the bacterium Micromonospora. This derivative exhibits its mode of action by binding to the 30S subunit of the bacterial ribosome, disrupting protein synthesis. As a result, it causes misreading of mRNA, ultimately leading to cell death, thereby exhibiting bactericidal effects.Formula:C19H38N4O10Purity:Min. 95%Molecular weight:482.5 g/molRef: 4Z-G-044018
Discontinued product

