
CAS 3689-69-8
:6,10,14-Trimethyl-5-pentadecen-2-one
Description:
6,10,14-Trimethyl-5-pentadecen-2-one, with the CAS number 3689-69-8, is an organic compound belonging to the class of ketones. It features a long carbon chain, specifically a pentadecene backbone, which contributes to its unique properties. The presence of multiple methyl groups at the 6, 10, and 14 positions enhances its hydrophobic character and influences its boiling and melting points. This compound is typically characterized by a distinct odor, which can be attributed to its structural configuration. It is often utilized in the synthesis of fragrances and flavoring agents due to its pleasant aroma. Additionally, its unsaturated nature allows for potential reactivity in various chemical reactions, making it a valuable intermediate in organic synthesis. The compound is generally stable under standard conditions but may undergo oxidation or polymerization under certain circumstances. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 6,10,14-Trimethyl-5-pentadecen-2-one is notable for its structural complexity and applications in the chemical industry.
Formula:C18H34O
InChI:InChI=1S/C18H34O/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19/h13,15-16H,6-12,14H2,1-5H3
InChI key:InChIKey=CKJHJTOHWZLGFY-UHFFFAOYSA-N
SMILES:C(CCCC(=CCCC(C)=O)C)(CCCC(C)C)C
Synonyms:- Dehydrophytone
- 6,10,14-Trimethyl-5-pentadecen-2-one
- 5-Pentadecen-2-one, 6,10,14-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
