
CAS 36890-68-3
:Poly(caprolactone) diol
Description:
Poly(caprolactone) diol, with the CAS number 36890-68-3, is a biodegradable polyester that is derived from the polymerization of ε-caprolactone. This substance is characterized by its flexible and elastomeric properties, making it suitable for various applications, including the production of polyurethanes, adhesives, and coatings. Poly(caprolactone) diol typically exhibits a low melting point and good thermal stability, which allows it to be processed easily. It is soluble in a variety of organic solvents, enhancing its versatility in formulations. Additionally, this diol is known for its biocompatibility, making it an attractive option for biomedical applications, such as drug delivery systems and tissue engineering. Its biodegradability is a significant advantage, as it can break down into non-toxic byproducts in the environment. Overall, poly(caprolactone) diol is valued for its unique combination of mechanical properties, processability, and environmental friendliness.
Formula:(C6H10O2)xC4H10O3
InChI:InChI=1S/C6H10O2.C4H10O3/c7-6-4-2-1-3-5-8-6;5-1-3-7-4-2-6/h1-5H2;5-6H,1-4H2
InChI key:InChIKey=QQTRSFMAONGASB-UHFFFAOYSA-N
SMILES:O(CCO)CCO.O=C1CCCCCO1
Synonyms:- 2-Oxepanone, polymer with 2,2'-oxybis(ethanol)
- Caprolactone-diethylene glycol polymer
- Diethyl glycol, epsilon-caprolactone polymer
- Diethylene glycol, caprolactone copolymer
- Diethylene glycol-ε-caprolactone polymer
- Ethanol, 2,2′-oxybis-, polymer with 2-oxepanone
- ε-Caprolactone-diethylene glycol copolymer
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Polycaprolactone Diol
CAS:Polycaprolactone DiolFormula:C4H8O3(C6H10O2)nPurity:average Mn ~530Color and Shape:LiquidPolycaprolactone oxydiethylene ester
CAS:Formula:C10H20O5Color and Shape:SolidMolecular weight:220.2628Polycaprolactone
CAS:Polycaprolactone is a biodegradable synthetic polymer that has been shown to have antimicrobial properties. Polycaprolactone has been used in wastewater treatment and has shown to inhibit the growth of histological analysis, vivo model, vitro assays, polyvinyl, collagen, carcinoma cell lines, tissue culture, ethylene diamine, water vapor, cell culture and hydrogen bond. In studies with wild-type strains of bacteria such as Escherichia coli and Staphylococcus aureus, it showed activity against both Gram-positive and Gram-negative bacteria. It also showed activity against the bacterium that causes tuberculosis (M. tuberculosis).
Formula:(C6H10O2)nPurity:Min. 95%



