CAS 369-24-4
:2-fluoro-4-pyridine carboxlic acid
Description:
2-Fluoro-4-pyridinecarboxylic acid, with the CAS number 369-24-4, is an aromatic carboxylic acid featuring a pyridine ring substituted with a fluorine atom and a carboxylic acid group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group. The fluorine atom introduces unique electronic properties, influencing the acidity and reactivity of the compound. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as with many chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C6H4FNO2
InChI:InChI=1/C6H4FNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3H,(H,9,10)
SMILES:c1cnc(cc1C(=O)O)F
Synonyms:- 2-Fluoroisoniazide
- 2-Fluoropyridine-4-Carbohydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

