CymitQuimica logo

CAS 369-25-5

:

Benzoic acid, 3,4-difluoro-, methyl ester

Description:
Benzoic acid, 3,4-difluoro-, methyl ester, with the CAS number 369-25-5, is an organic compound characterized by its aromatic structure and the presence of both fluorine substituents and a methoxy group. This compound features a benzoic acid backbone, where two fluorine atoms are positioned at the 3 and 4 positions of the aromatic ring, contributing to its unique chemical properties. The methyl ester functional group indicates that it is an ester formed from benzoic acid and methanol, which can influence its solubility and reactivity. Generally, compounds like this exhibit moderate polarity due to the presence of the ester group, while the fluorine atoms can enhance lipophilicity and alter the compound's reactivity and interaction with biological systems. Additionally, the presence of fluorine can impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C8H6F2O2
InChI:InChI=1S/C8H6F2O2/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4H,1H3
InChI key:InChIKey=DWRVHDWKWKFSAI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(F)=C(F)C=C1
Synonyms:
  • 3,4-Difluorobenzoic acid methyl ester
  • Benzoic acid, 3,4-difluoro-, methyl ester
  • Methyl 3-Amino-4-Fluorobenzoate
  • Methyl 3,4-difluorobenzoate
Found 4 products.