CAS 36916-36-6

2-benzyl-4-(chloromethyl)-1,3-thiazole

Description:

2-benzyl-4-(chloromethyl)-1,3-thiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features a benzyl group and a chloromethyl substituent, contributing to its reactivity and potential applications in organic synthesis. The thiazole moiety is known for its biological activity, making derivatives of this compound of interest in medicinal chemistry. Typically, compounds like this exhibit moderate to high lipophilicity due to the aromatic benzyl group, which can influence their solubility and permeability in biological systems. The presence of the chloromethyl group may also enhance electrophilic reactivity, allowing for further chemical modifications. Overall, 2-benzyl-4-(chloromethyl)-1,3-thiazole is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and materials science, although specific properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications.

Formula: C₁₁H₁₀ClNS

InChI: InChI=1/C11H10ClNS/c12-7-10-8-14-11(13-10)6-9-4-2-1-3-5-9/h1-5,8H,6-7H2

InChI key: OBQYFPBESLPHHK-UHFFFAOYSA-N

SMILES: c1ccc(cc1)Cc1nc(CCl)cs1

Synonyms:

• Thiazole, 4-(Chloromethyl)-2-(Phenylmethyl)-