CAS 36919-03-6
:Methyl 2,3,4,5,6-pentafluorophenyl carbonate
Description:
Methyl 2,3,4,5,6-pentafluorophenyl carbonate is a fluorinated organic compound characterized by the presence of a carbonate functional group attached to a pentafluorophenyl moiety. The structure features five fluorine atoms substituted on a phenyl ring, which significantly enhances its chemical stability and alters its reactivity compared to non-fluorinated analogs. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It exhibits low volatility and is generally insoluble in water, but may dissolve in organic solvents. The presence of multiple fluorine atoms contributes to its unique properties, such as increased lipophilicity and potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the carbonate group can participate in various chemical reactions, making it a versatile intermediate in synthetic chemistry. Safety precautions should be taken when handling this compound, as fluorinated compounds can exhibit toxicity and environmental persistence.
Formula:C8H3F5O3
InChI:InChI=1S/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3
InChI key:InChIKey=HGYOVHMDBHQLOE-UHFFFAOYSA-N
SMILES:O(C(OC)=O)C1=C(F)C(F)=C(F)C(F)=C1F
Synonyms:- Carbonic acid, methyl 2,3,4,5,6-pentafluorophenyl ester
- Carbonic acid, methyl pentafluorophenyl ester
- Methyl 2,3,4,5,6-pentafluorophenyl carbonate
- Pentafluorophenyl methyl carbonate
- Methyl pentafluorophenyl carbonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl Pentafluorophenyl Carbonate
CAS:Formula:C8H3F5O3Purity:98%Color and Shape:SolidMolecular weight:242.0996Methyl Pentafluorophenyl Carbonate
CAS:Methyl Pentafluorophenyl CarbonatePurity:98%Molecular weight:242.10g/molMethyl Pentafluorophenyl Carbonate
CAS:Formula:C8H3F5O3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to lumpMolecular weight:242.10METHYL (PERFLUOROPHENYL) CARBONATE
CAS:Formula:C8H3F5O3Purity:98%Color and Shape:Solid, LumpsMolecular weight:242.101Methyl pentafluorophenyl carbonate, 97%
CAS:<p>Methyl pentafluorophenyl carbonate This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.</p>Formula:C8H3F5O3Purity:97%Color and Shape:White, Crystals or powder or crystalline powder or fused solidMolecular weight:242.10




