CAS 36923-17-8
:7-Amino-3-cephem-4-carboxylic acid
Description:
7-Amino-3-cephem-4-carboxylic acid, also known as a cephalosporin antibiotic, is characterized by its beta-lactam structure, which is essential for its antibacterial activity. This compound features a bicyclic structure that includes a six-membered dihydrothiazine ring fused to a beta-lactam ring, contributing to its stability and reactivity. The presence of an amino group at the 7-position enhances its spectrum of activity against various Gram-positive and Gram-negative bacteria. The carboxylic acid group at the 4-position is crucial for solubility and bioactivity. This compound is typically used as a precursor in the synthesis of more complex cephalosporin antibiotics. Its mechanism of action involves inhibiting bacterial cell wall synthesis, leading to cell lysis and death. Additionally, 7-Amino-3-cephem-4-carboxylic acid is often studied for its potential modifications to improve pharmacological properties, such as increased efficacy and reduced resistance. Overall, its structural features and biological activity make it an important compound in the field of medicinal chemistry and antibiotic development.
Formula:C7H8N2O3S
InChI:InChI=1S/C7H8N2O3S/c8-4-5(10)9-3(7(11)12)1-2-13-6(4)9/h1,4,6H,2,8H2,(H,11,12)/t4-,6-/m1/s1
InChI key:InChIKey=RJFPBECTFIUTHB-INEUFUBQSA-N
SMILES:C(O)(=O)C=1N2[C@@]([C@H](N)C2=O)(SCC1)[H]
Synonyms:- (6R,7R)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-amino-8-oxo-, (6R,7R)-
- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-amino-8-oxo-, (6R-trans)-
- 7-Amino-3-Cephem-4-Carboxylic Acid
- 7-Amino-3-norcephalosporanic acid
- 7-Anca
- 7β-Amino-3-cephem-4-carboxylic acid
- Ceph-3-em-4-carboxylic acid, 7β-amino-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-amino-8-oxo-,(6R,7R)-
CAS:Formula:C7H8N2O3SPurity:97%Color and Shape:SolidMolecular weight:200.21507-Anca
CAS:Formula:C7H8N2O3SPurity:(HPLC) ≥ 98.5%Color and Shape:White to off-white or pale yellow powder or crystalsMolecular weight:200.227-Amino-3-Cephem-4-Carboxylic Acid
CAS:7-Amino-3-Cephem-4-Carboxylic AcidPurity:97%Molecular weight:200.22g/mol(6R,7R)-7-Amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
CAS:Purity:95.0%Molecular weight:200.21000671386727-Amino-3-cephem-4-carboxylic acid
CAS:Used in synthesis of Cephalosporin antibioticsFormula:C7H8N2O3SPurity:Min. 95%Color and Shape:White Slightly Yellow PowderMolecular weight:200.22 g/mol7-Amino-3-cephem-4-carboxylic Acid
CAS:Controlled Product<p>Applications Reagent used in the preparation of Cephalosporin antibiotics.<br>References Choi, K., et al.: J. Antibiotics, 50, 279 (1997), Bharathi, C., et al.: J. Pharm. Biomed. Anal., 43, 733 (2007),<br></p>Formula:C7H8N2O3SColor and Shape:NeatMolecular weight:200.22






