CAS 36926-83-7

ethyl 2-aminoquinoline-3-carboxylate

Description:

Ethyl 2-aminoquinoline-3-carboxylate is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing both a benzene and a pyridine ring. This compound features an ethyl ester functional group, an amino group, and a carboxylate moiety, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the amino group allows for hydrogen bonding and can enhance solubility in polar solvents, while the ethyl ester can participate in various chemical reactions, such as hydrolysis or transesterification. Ethyl 2-aminoquinoline-3-carboxylate may exhibit biological activity, making it of interest in drug development and synthesis of bioactive molecules. Its molecular structure suggests potential for interactions with biological targets, which could lead to pharmacological applications. Additionally, the compound's properties, such as melting point, solubility, and spectral characteristics, can vary based on the specific conditions and purity of the sample. Overall, this compound represents a versatile scaffold for further chemical modifications and research in organic and medicinal chemistry.

Formula: C₁₂H₁₂N₂O₂

InChI: InChI=1/C12H12N2O2/c1-2-16-12(15)9-7-8-5-3-4-6-10(8)14-11(9)13/h3-7H,2H2,1H3,(H2,13,14)

SMILES: CCOC(=O)c1cc2ccccc2[nH]c1=N

Synonyms:

• 2-Amino-3-quinolinecarboxylic acid ethyl ester
• 2-AMINO-QUINOLINE-3-CARBOXYLIC ACID ETHYL ESTER
• ethyl 2-aminoquinoline-3-carboxylate
• 3-QUINOLINECARBOXYLIC ACID, 2-AMINO-, ETHYL ESTER

Ethyl 2-aminoquinoline-3-carboxylate

CAS: 36926-83-7

Formula: C₁₂H₁₂N₂O₂

Color and Shape: Solid

Molecular weight: 216.2359

Ref: IN-DA00C5NX

Ethyl-2-aminoquinoline-3-carboxylate

CAS: 36926-83-7

Ethyl-2-aminoquinoline-3-carboxylate is an intramolecular reductive coupling product. It was synthesized by the reductive coupling of nitrobenzene with triethylamine in the presence of a copper salt. The use of ethyl cyanoacetate as a starting material for this synthesis has been shown to produce regioselective products with high yields. Ethyl-2-aminoquinoline-3-carboxylate is used in the synthesis of quinoline derivatives and fluoroquinolone antibiotics. This compound has been shown to have optimum properties for GC/MS analysis, which makes it an advance in the field of chemistry.

Formula: C₁₂H₁₂N₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 216.24 g/mol

Ref: 3D-FE29513