CAS 36929-61-0

1-Methyl-1H-pyrrole-3-carboxylic acid

Description:

1-Methyl-1H-pyrrole-3-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a methyl group and a carboxylic acid functional group attached to the pyrrole ring, influencing its chemical reactivity and solubility. It is typically a colorless to pale yellow solid or liquid, depending on its purity and form. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the methyl group can affect the compound's steric and electronic properties, potentially influencing its interactions with biological systems or other chemical species. 1-Methyl-1H-pyrrole-3-carboxylic acid may be used in synthetic organic chemistry, pharmaceuticals, or as an intermediate in the production of more complex molecules. Its specific applications and behavior can vary based on the context of use and the presence of other functional groups in a given reaction.

Formula: C₆H₇NO₂

InChI: InChI=1/C6H7NO2/c1-7-3-2-5(4-7)6(8)9/h2-4H,1H3,(H,8,9)

SMILES: Cn1ccc(c1)C(=O)O

Synonyms:

• 1H-pyrrole-3-carboxylic acid, 1-methyl-

1H-PYRROLE-3-CARBOXYLIC ACID, 1-METHYL-

CAS: 36929-61-0

Formula: C₆H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 125.1253

Ref: IN-DA00CIQW

1-Methyl-1H-pyrrole-3-carboxylic acid

CAS: 36929-61-0

1-Methyl-1H-pyrrole-3-carboxylic acid

Purity: 98%

Molecular weight: 125.13g/mol

Ref: 54-OR906844

1-Methyl-1H-pyrrole-3-carboxylic acid

CAS: 36929-61-0

Formula: C₆H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 125.127

Ref: 10-F077125