CAS 36937-95-8
:(2,3-dimethoxybenzylidene)propanedinitrile
Description:
(2,3-Dimethoxybenzylidene)propanedinitrile, with the CAS number 36937-95-8, is an organic compound characterized by its unique structure that includes a benzylidene moiety and two cyano groups. This compound features a dimethoxy substitution on the benzene ring, which can influence its electronic properties and reactivity. The presence of the cyano groups contributes to its potential as a versatile building block in organic synthesis, particularly in the formation of various derivatives. The dimethoxy groups may enhance solubility in organic solvents and affect the compound's polarity. Additionally, the compound may exhibit interesting optical properties due to its conjugated system, making it of interest in materials science and organic electronics. Its reactivity can be attributed to the presence of the nitrile functional groups, which can participate in nucleophilic addition reactions. Overall, (2,3-dimethoxybenzylidene)propanedinitrile is a compound with potential applications in various fields, including pharmaceuticals and materials chemistry, due to its structural features and functional groups.
Formula:C12H10N2O2
InChI:InChI=1/C12H10N2O2/c1-15-11-5-3-4-10(12(11)16-2)6-9(7-13)8-14/h3-6H,1-2H3
SMILES:COc1cccc(C=C(C#N)C#N)c1OC
Synonyms:- 2-(2,3-Dimethoxybenzylidene)malononitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
