CAS 36958-62-0

5-(Bromomethyl)-3-ethylisoxazole

Description:

5-(Bromomethyl)-3-ethylisoxazole is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a bromomethyl group at the 5-position and an ethyl group at the 3-position contributes to its unique reactivity and properties. This compound typically exhibits moderate polarity due to the electronegative bromine atom and the heteroatoms in the isoxazole ring. It is often used in organic synthesis and medicinal chemistry, where its functional groups can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The compound's molecular structure allows for potential applications in the development of pharmaceuticals or agrochemicals. Additionally, its stability under standard laboratory conditions makes it a suitable candidate for further chemical modifications. Safety data should be consulted when handling this compound, as halogenated compounds can pose health risks. Overall, 5-(Bromomethyl)-3-ethylisoxazole is a versatile building block in synthetic organic chemistry.

Formula: C₆H₈BrNO

InChI: InChI=1S/C6H8BrNO/c1-2-5-3-6(4-7)9-8-5/h3H,2,4H2,1H3

InChI key: InChIKey=YCZVNYPFSNGXGJ-UHFFFAOYSA-N

SMILES: C(C)C=1C=C(CBr)ON1

Synonyms:

• Isoxazole, 5-(bromomethyl)-3-ethyl-
• 3-Ethyl-5-bromomethylisoxazole
• 5-(Bromomethyl)-3-ethylisoxazole

5-(Bromomethyl)-3-ethyl-1,2-oxazole

CAS: 36958-62-0

5-(Bromomethyl)-3-ethyl-1,2-oxazole is a hydroxylamine derivative that has been used in the synthesis of amines. It reacts with primary amines to form oxazoles. This compound has also been shown to react with hydroxylamine to form an oxazole. 5-(Bromomethyl)-3-ethyl-1,2-oxazole is a white solid that can be synthesized by reacting aniline with bromoethane and ethylhydroxyamine in the presence of hydrochloric acid.

Formula: C₆H₈BrNO

Purity: Min. 95%

Molecular weight: 190.04 g/mol

Ref: 3D-LBA95862