CAS 3696-23-9
:N-(4-Chlorophenyl)thiourea
Description:
N-(4-Chlorophenyl)thiourea is an organic compound characterized by the presence of a thiourea functional group attached to a 4-chlorophenyl moiety. It typically appears as a white to off-white crystalline solid. The compound is known for its moderate solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. Its molecular structure includes a thiourea group, which consists of a carbon atom double-bonded to a sulfur atom and bonded to two amine groups, contributing to its reactivity and potential applications in various chemical reactions. N-(4-Chlorophenyl)thiourea is often utilized in organic synthesis, particularly in the preparation of other chemical compounds and as a reagent in various chemical transformations. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.
Formula:C7H7ClN2S
InChI:InChI=1S/C7H7ClN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11)
InChI key:InChIKey=XVEFWRUIYOXUGG-UHFFFAOYSA-N
SMILES:N(C(N)=S)C1=CC=C(Cl)C=C1
Synonyms:- (4-Chlorophenyl)thiourea
- 1-(4-Chlorophenyl)Thiourea
- 1-(p-Chlorophenyl)-2-thiourea
- 1-(p-Chlorophenyl)thiourea
- 4-Chlorophenyl-2-thiourea
- Brn 0973258
- N-(4-Chlorophenyl)thiourea
- N-(p-Chlorophenyl)thiourea
- Nsc 72217
- N′-(4-Chlorophenyl)carbamimidothioic acid
- Thiourea, (4-chlorophenyl)-
- Thiourea, (4-chlorophenyl)- (9CI)
- Thiourea, N-(4-chlorophenyl)-
- Thourea, (4-chlorophenyl)- (9CI)
- Urea, 1-(p-chlorophenyl)-2-thio-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(4-Chlorophenyl)thiourea
CAS:Formula:C7H7ClN2SPurity:>98.0%(HPLC)(N)Color and Shape:White to Light yellow powder to crystalMolecular weight:186.661-(4-Chlorophenyl)thiourea
CAS:Formula:C7H7ClN2SPurity:97%Color and Shape:SolidMolecular weight:186.66194-Chlorophenylthiourea
CAS:4-ChlorophenylthioureaFormula:C7H7ClN2SPurity:≥95%Color and Shape: pale cream powderMolecular weight:186.66g/mol1-(4-Chlorophenyl)-2-thiourea
CAS:Formula:C7H7ClN2SPurity:97%Color and Shape:SolidMolecular weight:186.66a-(4-Chlorophenyl)thio urea
CAS:The a-(4-chlorophenyl)thio urea is an efficient method for the synthesis of thiourea derivatives. The method involves chlorinating the corresponding amine with chlorine gas and adding a solution of potassium azide in water to give the 4-chlorophenylthio urea. This reaction is catalyzed by hydrochloric acid or other strong mineral acids. The product is purified by recrystallization and characterized by melting point, IR spectroscopy, elemental analysis, and NMR spectroscopy. The compounds are effective inhibitors of melanogenesis and have potent inhibitory activity against ABCA1.Formula:C7H7ClN2SPurity:Min. 95%Molecular weight:186.66 g/mol




